C18H14BN3O5 — CID 90113370
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(3-oxobutoxy)pyridine-3,5-dicarbonitrile (PubChem CID 90113370) has the molecular formula C18H14BN3O5 and a molecular weight of 363.14 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(3-oxobutoxy)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(3-oxobutoxy)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 90113370 |
| Molecular Formula | C18H14BN3O5 |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(3-oxobutoxy)pyridine-3,5-dicarbonitrile |
| SMILES | CC(=O)CCOc1nc(Oc2ccc3c(c2)COB3O)c(C#N)cc1C#N |
| InChI | InChI=1S/C18H14BN3O5/c1-11(23)4-5-25-17-12(8-20)6-13(9-21)18(22-17)27-15-2-3-16-14(7-15)10-26-19(16)24/h2-3,6-7,24H,4-5,10H2,1H3 |
| InChIKey | PBXUPLGMOOSHKR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|