C18H15BClFN2O5 — CID 66726665
5-chloro-6-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(4-oxopentoxy)pyridine-3-carbonitrile (PubChem CID 66726665) has the molecular formula C18H15BClFN2O5 and a molecular weight of 404.59 g/mol. Its IUPAC name is 5-chloro-6-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(4-oxopentoxy)pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(4-oxopentoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 66726665 |
| Molecular Formula | C18H15BClFN2O5 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 5-chloro-6-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(4-oxopentoxy)pyridine-3-carbonitrile |
| SMILES | CC(=O)CCCOc1nc(Oc2cc(F)c3c(c2)COB3O)c(Cl)cc1C#N |
| InChI | InChI=1S/C18H15BClFN2O5/c1-10(24)3-2-4-26-17-11(8-22)6-14(20)18(23-17)28-13-5-12-9-27-19(25)16(12)15(21)7-13/h5-7,25H,2-4,9H2,1H3 |
| InChIKey | XONFIBGUKUGPPG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|