C17H15BN2O6 — CID 67439657
2-[[3-cyano-6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-pyridinyl]oxy]ethyl acetate (PubChem CID 67439657) has the molecular formula C17H15BN2O6 and a molecular weight of 354.13 g/mol. Its IUPAC name is 2-[[3-cyano-6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-pyridinyl]oxy]ethyl acetate.
| Compound Name | 2-[[3-cyano-6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-pyridinyl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 67439657 |
| Molecular Formula | C17H15BN2O6 |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[[3-cyano-6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-pyridinyl]oxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1nc(Oc2ccc3c(c2)COB3O)ccc1C#N |
| InChI | InChI=1S/C17H15BN2O6/c1-11(21)23-6-7-24-17-12(9-19)2-5-16(20-17)26-14-3-4-15-13(8-14)10-25-18(15)22/h2-5,8,22H,6-7,10H2,1H3 |
| InChIKey | XIMHZMKMSZOFRT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|