C18H16BNO6 — CID 67440007
ethyl 2-[5-cyano-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenoxy]acetate (PubChem CID 67440007) has the molecular formula C18H16BNO6 and a molecular weight of 353.14 g/mol. Its IUPAC name is ethyl 2-[5-cyano-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenoxy]acetate.
| Compound Name | ethyl 2-[5-cyano-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenoxy]acetate |
|---|---|
| PubChem CID | 67440007 |
| Molecular Formula | C18H16BNO6 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl 2-[5-cyano-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(C#N)ccc1Oc1ccc2c(c1)COB2O |
| InChI | InChI=1S/C18H16BNO6/c1-2-23-18(21)11-24-17-7-12(9-20)3-6-16(17)26-14-4-5-15-13(8-14)10-25-19(15)22/h3-8,22H,2,10-11H2,1H3 |
| InChIKey | SVUYCIQRWLNASN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|