C19H18BN3O5 — CID 140647218
2-[(3,3-dideuterio-1-hydroxy-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-(2-propan-2-yloxyethoxy)pyridine-3-carbonitrile (PubChem CID 140647218) has the molecular formula C19H18BN3O5 and a molecular weight of 381.19 g/mol. Its IUPAC name is 2-[(3,3-dideuterio-1-hydroxy-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-(2-propan-2-yloxyethoxy)pyridine-3-carbonitrile.
| Compound Name | 2-[(3,3-dideuterio-1-hydroxy-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-(2-propan-2-yloxyethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140647218 |
| Molecular Formula | C19H18BN3O5 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[(3,3-dideuterio-1-hydroxy-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-(2-propan-2-yloxyethoxy)pyridine-3-carbonitrile |
| SMILES | [2H]C1([2H])OB(O)c2ccc(Oc3nc(OCCOC(C)C)c([N+]#[C-])cc3C#N)cc21 |
| InChI | InChI=1S/C19H18BN3O5/c1-12(2)25-6-7-26-19-17(22-3)9-13(10-21)18(23-19)28-15-4-5-16-14(8-15)11-27-20(16)24/h4-5,8-9,12,24H,6-7,11H2,1-2H3/i11D2 |
| InChIKey | MXFMLGUXTSPLPC-ZWGOZCLVSA-N |
| XLogP | 2.32 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|