C17H14BN3O — CID 159392743
5-isocyano-2-[methyl-(1-methyl-3H-2,1-benzoxaborol-5-yl)amino]benzonitrile (PubChem CID 159392743) has the molecular formula C17H14BN3O and a molecular weight of 287.13 g/mol. Its IUPAC name is 5-isocyano-2-[methyl-(1-methyl-3H-2,1-benzoxaborol-5-yl)amino]benzonitrile.
| Compound Name | 5-isocyano-2-[methyl-(1-methyl-3H-2,1-benzoxaborol-5-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 159392743 |
| Molecular Formula | C17H14BN3O |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-isocyano-2-[methyl-(1-methyl-3H-2,1-benzoxaborol-5-yl)amino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(C)c2ccc3c(c2)COB3C)c(C#N)c1 |
| InChI | InChI=1S/C17H14BN3O/c1-18-16-6-5-15(9-13(16)11-22-18)21(3)17-7-4-14(20-2)8-12(17)10-19/h4-9H,11H2,1,3H3 |
| InChIKey | GPQXJKACHPWFGB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|