C15H14BN3O2 — CID 58333218
N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-isocyano-N,4-dimethylpyridin-2-amine (PubChem CID 58333218) has the molecular formula C15H14BN3O2 and a molecular weight of 279.11 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-isocyano-N,4-dimethylpyridin-2-amine.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-isocyano-N,4-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 58333218 |
| Molecular Formula | C15H14BN3O2 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-isocyano-N,4-dimethylpyridin-2-amine |
| SMILES | [C-]#[N+]c1cnc(N(C)c2ccc3c(c2)COB3O)cc1C |
| InChI | InChI=1S/C15H14BN3O2/c1-10-6-15(18-8-14(10)17-2)19(3)12-4-5-13-11(7-12)9-21-16(13)20/h4-8,20H,9H2,1,3H3 |
| InChIKey | GTIJOMDKDGHMGM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|