C7H8BClO2 — CID 140657530
1-hydroxy-3H-2,1-benzoxaborole;hydrochloride (PubChem CID 140657530) has the molecular formula C7H8BClO2 and a molecular weight of 170.40 g/mol. Its IUPAC name is 1-hydroxy-3H-2,1-benzoxaborole;hydrochloride.
| Compound Name | 1-hydroxy-3H-2,1-benzoxaborole;hydrochloride |
|---|---|
| PubChem CID | 140657530 |
| Molecular Formula | C7H8BClO2 |
| Molecular Weight | 170.40 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 1-hydroxy-3H-2,1-benzoxaborole;hydrochloride |
| SMILES | Cl.OB1OCc2ccccc21 |
| InChI | InChI=1S/C7H7BO2.ClH/c9-8-7-4-2-1-3-6(7)5-10-8;/h1-4,9H,5H2;1H |
| InChIKey | YPJAQGJSXGHWQR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|