C10H12BNO3 — CID 58404201
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-methylacetamide (PubChem CID 58404201) has the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-methylacetamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 58404201 |
| Molecular Formula | C10H12BNO3 |
| Molecular Weight | 205.02 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C10H12BNO3/c1-7(13)12(2)9-4-3-8-6-15-11(14)10(8)5-9/h3-5,14H,6H2,1-2H3 |
| InChIKey | PPHRECOBNPERMN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.02 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|