C15H15BFNO2 — CID 164613566
4-(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline (PubChem CID 164613566) has the molecular formula C15H15BFNO2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 4-(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164613566 |
| Molecular Formula | C15H15BFNO2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(4-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2OB(O)c3cccc(F)c32)cc1 |
| InChI | InChI=1S/C15H15BFNO2/c1-18(2)11-8-6-10(7-9-11)15-14-12(16(19)20-15)4-3-5-13(14)17/h3-9,15,19H,1-2H3 |
| InChIKey | XBNZCPAWEBAFJL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|