C15H15BClNO2 — CID 164617486
4-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline (PubChem CID 164617486) has the molecular formula C15H15BClNO2 and a molecular weight of 287.56 g/mol. Its IUPAC name is 4-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164617486 |
| Molecular Formula | C15H15BClNO2 |
| Molecular Weight | 287.56 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2OB(O)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H15BClNO2/c1-18(2)12-6-3-10(4-7-12)15-13-9-11(17)5-8-14(13)16(19)20-15/h3-9,15,19H,1-2H3 |
| InChIKey | BBNXKBWPPCQJID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|