C9H9BO4 — CID 139271327
methyl 1-hydroxy-3H-2,1-benzoxaborole-5-carboxylate (PubChem CID 139271327) has the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. Its IUPAC name is methyl 1-hydroxy-3H-2,1-benzoxaborole-5-carboxylate.
| Compound Name | methyl 1-hydroxy-3H-2,1-benzoxaborole-5-carboxylate |
|---|---|
| PubChem CID | 139271327 |
| Molecular Formula | C9H9BO4 |
| Molecular Weight | 191.98 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | methyl 1-hydroxy-3H-2,1-benzoxaborole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)COB2O |
| InChI | InChI=1S/C9H9BO4/c1-13-9(11)6-2-3-8-7(4-6)5-14-10(8)12/h2-4,12H,5H2,1H3 |
| InChIKey | VVYSGAZZHKLEDZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.98 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|