C13H17BO5 — CID 147159189
1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4,4-dimethoxybutan-1-one (PubChem CID 147159189) has the molecular formula C13H17BO5 and a molecular weight of 264.09 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4,4-dimethoxybutan-1-one.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4,4-dimethoxybutan-1-one |
|---|---|
| PubChem CID | 147159189 |
| Molecular Formula | C13H17BO5 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4,4-dimethoxybutan-1-one |
| SMILES | COC(CCC(=O)c1ccc2c(c1)B(O)OC2)OC |
| InChI | InChI=1S/C13H17BO5/c1-17-13(18-2)6-5-12(15)9-3-4-10-8-19-14(16)11(10)7-9/h3-4,7,13,16H,5-6,8H2,1-2H3 |
| InChIKey | BVMLRLYEKWFWCN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|