C20H22BNO5 — CID 145400125
methyl (2R)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-5-phenylpentanoate (PubChem CID 145400125) has the molecular formula C20H22BNO5 and a molecular weight of 367.21 g/mol. Its IUPAC name is methyl (2R)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-5-phenylpentanoate.
| Compound Name | methyl (2R)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 145400125 |
| Molecular Formula | C20H22BNO5 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl (2R)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-5-phenylpentanoate |
| SMILES | COC(=O)[C@@H](CCCc1ccccc1)NC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C20H22BNO5/c1-26-20(24)18(9-5-8-14-6-3-2-4-7-14)22-19(23)15-10-11-16-13-27-21(25)17(16)12-15/h2-4,6-7,10-12,18,25H,5,8-9,13H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | VSRFKTCUHCQFMC-GOSISDBHSA-N |
| XLogP | 1.20 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|