C24H29B2N3O9 — CID 170597460
3-[[(4R)-1-hydroxy-4,5-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]pentyl]amino]propanoic acid (PubChem CID 170597460) has the molecular formula C24H29B2N3O9 and a molecular weight of 525.13 g/mol. Its IUPAC name is 3-[[(4R)-1-hydroxy-4,5-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]pentyl]amino]propanoic acid.
| Compound Name | 3-[[(4R)-1-hydroxy-4,5-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]pentyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170597460 |
| Molecular Formula | C24H29B2N3O9 |
| Molecular Weight | 525.13 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-[[(4R)-1-hydroxy-4,5-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]pentyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(O)CC[C@H](CNC(=O)c1ccc2c(c1)B(O)OC2)NC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C24H29B2N3O9/c30-21(27-8-7-22(31)32)6-5-18(29-24(34)15-2-4-17-13-38-26(36)20(17)10-15)11-28-23(33)14-1-3-16-12-37-25(35)19(16)9-14/h1-4,9-10,18,21,27,30,35-36H,5-8,11-13H2,(H,28,33)(H,29,34)(H,31,32)/t18-,21?/m1/s1 |
| InChIKey | YOSBKFHZQQWWKP-ITUIMRKVSA-N |
| XLogP | -2.19 |
| TPSA | 186.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.13 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|