C14H13BN2O3 — CID 157476227
1-hydroxy-N-(pyridin-3-ylmethyl)-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 157476227) has the molecular formula C14H13BN2O3 and a molecular weight of 268.08 g/mol. Its IUPAC name is 1-hydroxy-N-(pyridin-3-ylmethyl)-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | 1-hydroxy-N-(pyridin-3-ylmethyl)-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 157476227 |
| Molecular Formula | C14H13BN2O3 |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-hydroxy-N-(pyridin-3-ylmethyl)-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C14H13BN2O3/c18-14(17-8-10-2-1-5-16-7-10)11-3-4-12-9-20-15(19)13(12)6-11/h1-7,19H,8-9H2,(H,17,18) |
| InChIKey | BVPVLRMIDNPJME-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|