C14H10ClN3O2 — CID 100787087
2-chloro-N-(pyridin-3-ylmethyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 100787087) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 2-chloro-N-(pyridin-3-ylmethyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-chloro-N-(pyridin-3-ylmethyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 100787087 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-chloro-N-(pyridin-3-ylmethyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc2oc(Cl)nc2c1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-14-18-11-6-10(3-4-12(11)20-14)13(19)17-8-9-2-1-5-16-7-9/h1-7H,8H2,(H,17,19) |
| InChIKey | ZTFZDNVPWQTRNR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |