C20H14ClN3O2 — CID 134800464
N-benzyl-2-(2-chloro-4-pyridinyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 134800464) has the molecular formula C20H14ClN3O2 and a molecular weight of 363.80 g/mol. Its IUPAC name is N-benzyl-2-(2-chloro-4-pyridinyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-benzyl-2-(2-chloro-4-pyridinyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 134800464 |
| Molecular Formula | C20H14ClN3O2 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-benzyl-2-(2-chloro-4-pyridinyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2oc(-c3ccnc(Cl)c3)nc2c1 |
| InChI | InChI=1S/C20H14ClN3O2/c21-18-11-15(8-9-22-18)20-24-16-10-14(6-7-17(16)26-20)19(25)23-12-13-4-2-1-3-5-13/h1-11H,12H2,(H,23,25) |
| InChIKey | IYSJWZFPHJNHEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|