C14H21BO4Si — CID 140761896
3-trimethylsilylpropyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (PubChem CID 140761896) has the molecular formula C14H21BO4Si and a molecular weight of 292.22 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate.
| Compound Name | 3-trimethylsilylpropyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
|---|---|
| PubChem CID | 140761896 |
| Molecular Formula | C14H21BO4Si |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-trimethylsilylpropyl 1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| SMILES | C[Si](C)(C)CCCOC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C14H21BO4Si/c1-20(2,3)8-4-7-18-14(16)11-5-6-12-10-19-15(17)13(12)9-11/h5-6,9,17H,4,7-8,10H2,1-3H3 |
| InChIKey | RQACVZIQRGGRFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|