C12H12BF3O3 — CID 159456075
5,5,5-trifluoro-1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pentan-1-one (PubChem CID 159456075) has the molecular formula C12H12BF3O3 and a molecular weight of 272.03 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pentan-1-one.
| Compound Name | 5,5,5-trifluoro-1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pentan-1-one |
|---|---|
| PubChem CID | 159456075 |
| Molecular Formula | C12H12BF3O3 |
| Molecular Weight | 272.03 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5,5,5-trifluoro-1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C12H12BF3O3/c14-12(15,16)5-1-2-11(17)8-3-4-9-7-19-13(18)10(9)6-8/h3-4,6,18H,1-2,5,7H2 |
| InChIKey | LTZHQEMUNVUWDP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.03 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|