C16H14BClO3 — CID 158530517
1-(3-chloro-4-methylphenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 158530517) has the molecular formula C16H14BClO3 and a molecular weight of 300.55 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 158530517 |
| Molecular Formula | C16H14BClO3 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccc3c(c2)B(O)OC3)cc1Cl |
| InChI | InChI=1S/C16H14BClO3/c1-10-2-4-12(8-15(10)18)16(19)7-11-3-5-13-9-21-17(20)14(13)6-11/h2-6,8,20H,7,9H2,1H3 |
| InChIKey | PEMQQEHZBMBONB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|