C15H11BClFO3 — CID 58373122
1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 58373122) has the molecular formula C15H11BClFO3 and a molecular weight of 304.51 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 58373122 |
| Molecular Formula | C15H11BClFO3 |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OC2)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H11BClFO3/c17-14-7-11(18)3-4-12(14)15(19)6-9-1-2-10-8-21-16(20)13(10)5-9/h1-5,7,20H,6,8H2 |
| InChIKey | UNEKVQFQWRDYOD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|