C17H15BClFO3 — CID 58373069
1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 58373069) has the molecular formula C17H15BClFO3 and a molecular weight of 332.57 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 58373069 |
| Molecular Formula | C17H15BClFO3 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | CC1(C)OB(O)c2cc(CC(=O)c3ccc(F)cc3Cl)ccc21 |
| InChI | InChI=1S/C17H15BClFO3/c1-17(2)13-6-3-10(7-14(13)18(22)23-17)8-16(21)12-5-4-11(20)9-15(12)19/h3-7,9,22H,8H2,1-2H3 |
| InChIKey | YNMKRFKGQIALGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|