C20H22BClO3 — CID 58373076
1-(2-chloro-4-propylphenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 58373076) has the molecular formula C20H22BClO3 and a molecular weight of 356.66 g/mol. Its IUPAC name is 1-(2-chloro-4-propylphenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-(2-chloro-4-propylphenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 58373076 |
| Molecular Formula | C20H22BClO3 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(2-chloro-4-propylphenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | CCCc1ccc(C(=O)Cc2ccc3c(c2)B(O)OC3(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H22BClO3/c1-4-5-13-6-8-15(18(22)11-13)19(23)12-14-7-9-16-17(10-14)21(24)25-20(16,2)3/h6-11,24H,4-5,12H2,1-3H3 |
| InChIKey | ZEKSKSNDIBETOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|