C22H26BClN2O3 — CID 159196381
1-[2-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 159196381) has the molecular formula C22H26BClN2O3 and a molecular weight of 412.73 g/mol. Its IUPAC name is 1-[2-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-[2-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 159196381 |
| Molecular Formula | C22H26BClN2O3 |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[2-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | CN1CCN(c2ccc(C(=O)Cc3ccc4c(c3)B(O)OC4(C)C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H26BClN2O3/c1-22(2)18-7-4-15(12-19(18)23(28)29-22)13-21(27)17-6-5-16(14-20(17)24)26-10-8-25(3)9-11-26/h4-7,12,14,28H,8-11,13H2,1-3H3 |
| InChIKey | KOSFZIABGFHPAE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|