C18H17BClFO2 — CID 158982385
1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2H-1-benzoborol-6-yl)ethanone (PubChem CID 158982385) has the molecular formula C18H17BClFO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2H-1-benzoborol-6-yl)ethanone.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2H-1-benzoborol-6-yl)ethanone |
|---|---|
| PubChem CID | 158982385 |
| Molecular Formula | C18H17BClFO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2H-1-benzoborol-6-yl)ethanone |
| SMILES | CC1(C)CB(O)c2cc(CC(=O)c3ccc(F)cc3Cl)ccc21 |
| InChI | InChI=1S/C18H17BClFO2/c1-18(2)10-19(23)15-7-11(3-6-14(15)18)8-17(22)13-5-4-12(21)9-16(13)20/h3-7,9,23H,8,10H2,1-2H3 |
| InChIKey | JQBCGDDJYGGICX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|