C21H19BO3 — CID 58373188
2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-1-naphthalen-1-ylethanone (PubChem CID 58373188) has the molecular formula C21H19BO3 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-1-naphthalen-1-ylethanone.
| Compound Name | 2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-1-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 58373188 |
| Molecular Formula | C21H19BO3 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-1-naphthalen-1-ylethanone |
| SMILES | CC1(C)OB(O)c2cc(CC(=O)c3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C21H19BO3/c1-21(2)18-11-10-14(12-19(18)22(24)25-21)13-20(23)17-9-5-7-15-6-3-4-8-16(15)17/h3-12,24H,13H2,1-2H3 |
| InChIKey | QNWVCAREKAUTBS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|