C15H12BNO5 — CID 147212323
2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(2-nitrophenyl)ethanone (PubChem CID 147212323) has the molecular formula C15H12BNO5 and a molecular weight of 297.07 g/mol. Its IUPAC name is 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(2-nitrophenyl)ethanone.
| Compound Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 147212323 |
| Molecular Formula | C15H12BNO5 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(2-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OC2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12BNO5/c18-15(12-3-1-2-4-14(12)17(20)21)8-10-5-6-11-9-22-16(19)13(11)7-10/h1-7,19H,8-9H2 |
| InChIKey | URGNUYHKIKGYQW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|