C11H11NO4 — CID 43608280
1-(2-nitrophenyl)pentane-1,4-dione (PubChem CID 43608280) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 1-(2-nitrophenyl)pentane-1,4-dione.
| Compound Name | 1-(2-nitrophenyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 43608280 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-(2-nitrophenyl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO4/c1-8(13)6-7-11(14)9-4-2-3-5-10(9)12(15)16/h2-5H,6-7H2,1H3 |
| InChIKey | FLGRLGDPPUIBJO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|