About [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate
[2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate (PubChem CID 135078857) has the molecular formula C10H10N2O3S
and a molecular weight of 238.27 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate.
Molecular Properties
| Compound Name | [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate |
| PubChem CID | 135078857 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate |
| SMILES | [H]/N=C(\C)SCC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O3S/c1-7(11)16-6-10(13)8-4-2-3-5-9(8)12(14)15/h2-5,11H,6H2,1H3/b11-7+ |
| InChIKey | TYXFIVMAEHZSDR-YRNVUSSQSA-N |
| XLogP | 2.51 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate?
The IUPAC name of [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate (CID 135078857) is [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate.
What is the SMILES notation for [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate?
The canonical SMILES for [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate is [H]/N=C(\C)SCC(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate?
The InChIKey is TYXFIVMAEHZSDR-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H10N2O3S/c1-7(11)16-6-10(13)8-4-2-3-5-9(8)12(14)15/h2-5,11H,6H2,1H3/b11-7+.
What are the key properties of [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate?
[2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate has a molecular weight of 238.27 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-nitrophenyl)-2-oxoethyl] ethanimidothioate is sourced from PubChem (CID 135078857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).