About ethane;methane;1-(2-nitrophenyl)ethanone
ethane;methane;1-(2-nitrophenyl)ethanone (PubChem CID 161143607) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethane;methane;1-(2-nitrophenyl)ethanone.
Molecular Properties
| Compound Name | ethane;methane;1-(2-nitrophenyl)ethanone |
| PubChem CID | 161143607 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethane;methane;1-(2-nitrophenyl)ethanone |
| SMILES | C.CC.CC.CC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO3.2C2H6.CH4/c1-6(10)7-4-2-3-5-8(7)9(11)12;2*1-2;/h2-5H,1H3;2*1-2H3;1H4 |
| InChIKey | UNTOZYLBOUJGKL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;1-(2-nitrophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;1-(2-nitrophenyl)ethanone?
The IUPAC name of ethane;methane;1-(2-nitrophenyl)ethanone (CID 161143607) is ethane;methane;1-(2-nitrophenyl)ethanone.
What is the SMILES notation for ethane;methane;1-(2-nitrophenyl)ethanone?
The canonical SMILES for ethane;methane;1-(2-nitrophenyl)ethanone is C.CC.CC.CC(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of ethane;methane;1-(2-nitrophenyl)ethanone?
The InChIKey is UNTOZYLBOUJGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.2C2H6.CH4/c1-6(10)7-4-2-3-5-8(7)9(11)12;2*1-2;/h2-5H,1H3;2*1-2H3;1H4.
What are the key properties of ethane;methane;1-(2-nitrophenyl)ethanone?
ethane;methane;1-(2-nitrophenyl)ethanone has a molecular weight of 241.33 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;1-(2-nitrophenyl)ethanone is sourced from PubChem (CID 161143607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).