C17H14Cl2N2O5 — CID 159884604
1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene;1-(2-nitrophenyl)ethanone (PubChem CID 159884604) has the molecular formula C17H14Cl2N2O5 and a molecular weight of 397.21 g/mol. Its IUPAC name is 1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene;1-(2-nitrophenyl)ethanone.
| Compound Name | 1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene;1-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 159884604 |
| Molecular Formula | C17H14Cl2N2O5 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene;1-(2-nitrophenyl)ethanone |
| SMILES | CC(=C(Cl)Cl)c1ccccc1[N+](=O)[O-].CC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7Cl2NO2.C8H7NO3/c1-6(9(10)11)7-4-2-3-5-8(7)12(13)14;1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3;2-5H,1H3 |
| InChIKey | NTYUYJOJKNKZGP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|