C29H25B2F2NO7 — CID 159581465
4-fluorobenzoic acid;1-(4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone;1-hydroxy-3H-2,1-benzoxaborol-6-amine (PubChem CID 159581465) has the molecular formula C29H25B2F2NO7 and a molecular weight of 559.14 g/mol. Its IUPAC name is 4-fluorobenzoic acid;1-(4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone;1-hydroxy-3H-2,1-benzoxaborol-6-amine.
| Compound Name | 4-fluorobenzoic acid;1-(4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone;1-hydroxy-3H-2,1-benzoxaborol-6-amine |
|---|---|
| PubChem CID | 159581465 |
| Molecular Formula | C29H25B2F2NO7 |
| Molecular Weight | 559.14 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 4-fluorobenzoic acid;1-(4-fluorophenyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanone;1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| SMILES | Nc1ccc2c(c1)B(O)OC2.O=C(Cc1ccc2c(c1)B(O)OC2)c1ccc(F)cc1.O=C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12BFO3.C7H8BNO2.C7H5FO2/c17-13-5-3-11(4-6-13)15(18)8-10-1-2-12-9-20-16(19)14(12)7-10;9-6-2-1-5-4-11-8(10)7(5)3-6;8-6-3-1-5(2-4-6)7(9)10/h1-7,19H,8-9H2;1-3,10H,4,9H2;1-4H,(H,9,10) |
| InChIKey | MJBMHVWFSVVDNH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|