C17H13BF4O3 — CID 157261671
1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone (PubChem CID 157261671) has the molecular formula C17H13BF4O3 and a molecular weight of 352.09 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
|---|---|
| PubChem CID | 157261671 |
| Molecular Formula | C17H13BF4O3 |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OCC2)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13BF4O3/c19-12-3-4-13(14(9-12)17(20,21)22)16(23)8-10-1-2-11-5-6-25-18(24)15(11)7-10/h1-4,7,9,24H,5-6,8H2 |
| InChIKey | KPQKINQASVVMKB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|