C20H22BCl2F3O — CID 123455522
chloromethane;2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 123455522) has the molecular formula C20H22BCl2F3O and a molecular weight of 417.11 g/mol. Its IUPAC name is chloromethane;2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | chloromethane;2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 123455522 |
| Molecular Formula | C20H22BCl2F3O |
| Molecular Weight | 417.11 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | chloromethane;2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | CB1CCc2ccc(CC(=O)c3ccccc3C(F)(F)F)cc21.CCl.CCl |
| InChI | InChI=1S/C18H16BF3O.2CH3Cl/c1-19-9-8-13-7-6-12(10-16(13)19)11-17(23)14-4-2-3-5-15(14)18(20,21)22;2*1-2/h2-7,10H,8-9,11H2,1H3;2*1H3 |
| InChIKey | FELALCFYLQIPDW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.11 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|