C20H23BO2 — CID 58404299
2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(4-propan-2-yloxyphenyl)ethanone (PubChem CID 58404299) has the molecular formula C20H23BO2 and a molecular weight of 306.21 g/mol. Its IUPAC name is 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(4-propan-2-yloxyphenyl)ethanone.
| Compound Name | 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(4-propan-2-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 58404299 |
| Molecular Formula | C20H23BO2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(4-propan-2-yloxyphenyl)ethanone |
| SMILES | CB1CCc2ccc(CC(=O)c3ccc(OC(C)C)cc3)cc21 |
| InChI | InChI=1S/C20H23BO2/c1-14(2)23-18-8-6-17(7-9-18)20(22)13-15-4-5-16-10-11-21(3)19(16)12-15/h4-9,12,14H,10-11,13H2,1-3H3 |
| InChIKey | YUSNXBISYVYKIN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|