C16H17BO2 — CID 58404267
2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(3-methylfuran-2-yl)ethanone (PubChem CID 58404267) has the molecular formula C16H17BO2 and a molecular weight of 252.12 g/mol. Its IUPAC name is 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(3-methylfuran-2-yl)ethanone.
| Compound Name | 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(3-methylfuran-2-yl)ethanone |
|---|---|
| PubChem CID | 58404267 |
| Molecular Formula | C16H17BO2 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(1-methyl-2,3-dihydro-1-benzoborol-6-yl)-1-(3-methylfuran-2-yl)ethanone |
| SMILES | CB1CCc2ccc(CC(=O)c3occc3C)cc21 |
| InChI | InChI=1S/C16H17BO2/c1-11-6-8-19-16(11)15(18)10-12-3-4-13-5-7-17(2)14(13)9-12/h3-4,6,8-9H,5,7,10H2,1-2H3 |
| InChIKey | SFMBPWLZVTZLGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|