C14H13BrO2 — CID 63943802
1-(3-bromofuran-2-yl)-2-(3,4-dimethylphenyl)ethanone (PubChem CID 63943802) has the molecular formula C14H13BrO2 and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(3,4-dimethylphenyl)ethanone.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(3,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 63943802 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(3,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2occc2Br)cc1C |
| InChI | InChI=1S/C14H13BrO2/c1-9-3-4-11(7-10(9)2)8-13(16)14-12(15)5-6-17-14/h3-7H,8H2,1-2H3 |
| InChIKey | FILVWIVNXCNQIN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |