C15H16O2 — CID 114821172
2-(3,4-dimethylphenyl)-1-(5-methylfuran-3-yl)ethanone (PubChem CID 114821172) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-1-(5-methylfuran-3-yl)ethanone.
| Compound Name | 2-(3,4-dimethylphenyl)-1-(5-methylfuran-3-yl)ethanone |
|---|---|
| PubChem CID | 114821172 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-1-(5-methylfuran-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)Cc2ccc(C)c(C)c2)co1 |
| InChI | InChI=1S/C15H16O2/c1-10-4-5-13(6-11(10)2)8-15(16)14-7-12(3)17-9-14/h4-7,9H,8H2,1-3H3 |
| InChIKey | FTNASUCBTDSNLH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |