C17H17BO4 — CID 158784243
2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 158784243) has the molecular formula C17H17BO4 and a molecular weight of 296.13 g/mol. Its IUPAC name is 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 158784243 |
| Molecular Formula | C17H17BO4 |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2ccc3c(c2)B(O)OCC3)cc1 |
| InChI | InChI=1S/C17H17BO4/c1-21-15-6-4-14(5-7-15)17(19)11-12-2-3-13-8-9-22-18(20)16(13)10-12/h2-7,10,20H,8-9,11H2,1H3 |
| InChIKey | IRLXIJCTYZHLES-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|