C16H15BFNO3 — CID 158992983
1-(4-fluoro-6-methyl-3-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone (PubChem CID 158992983) has the molecular formula C16H15BFNO3 and a molecular weight of 299.11 g/mol. Its IUPAC name is 1-(4-fluoro-6-methyl-3-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone.
| Compound Name | 1-(4-fluoro-6-methyl-3-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
|---|---|
| PubChem CID | 158992983 |
| Molecular Formula | C16H15BFNO3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(4-fluoro-6-methyl-3-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
| SMILES | Cc1cc(F)c(C(=O)Cc2ccc3c(c2)B(O)OCC3)cn1 |
| InChI | InChI=1S/C16H15BFNO3/c1-10-6-15(18)13(9-19-10)16(20)8-11-2-3-12-4-5-22-17(21)14(12)7-11/h2-3,6-7,9,21H,4-5,8H2,1H3 |
| InChIKey | VOOQBRJGEAYWQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|