C11H15BO2 — CID 160565972
1-hydroxy-7-propyl-3,4-dihydro-2,1-benzoxaborinine (PubChem CID 160565972) has the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. Its IUPAC name is 1-hydroxy-7-propyl-3,4-dihydro-2,1-benzoxaborinine.
| Compound Name | 1-hydroxy-7-propyl-3,4-dihydro-2,1-benzoxaborinine |
|---|---|
| PubChem CID | 160565972 |
| Molecular Formula | C11H15BO2 |
| Molecular Weight | 190.05 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-hydroxy-7-propyl-3,4-dihydro-2,1-benzoxaborinine |
| SMILES | CCCc1ccc2c(c1)B(O)OCC2 |
| InChI | InChI=1S/C11H15BO2/c1-2-3-9-4-5-10-6-7-14-12(13)11(10)8-9/h4-5,8,13H,2-3,6-7H2,1H3 |
| InChIKey | QZXQMSNPTZMXDO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.05 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|