C17H17BO3 — CID 148831057
1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-phenylbutan-1-one (PubChem CID 148831057) has the molecular formula C17H17BO3 and a molecular weight of 280.13 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-phenylbutan-1-one.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 148831057 |
| Molecular Formula | C17H17BO3 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C17H17BO3/c19-17(8-4-7-13-5-2-1-3-6-13)14-9-10-15-12-21-18(20)16(15)11-14/h1-3,5-6,9-11,20H,4,7-8,12H2 |
| InChIKey | OTRMUHFPMXJUSP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|