C16H13BN4O3 — CID 157389294
2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(1-pyridin-2-yltriazol-4-yl)ethanone (PubChem CID 157389294) has the molecular formula C16H13BN4O3 and a molecular weight of 320.12 g/mol. Its IUPAC name is 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(1-pyridin-2-yltriazol-4-yl)ethanone.
| Compound Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(1-pyridin-2-yltriazol-4-yl)ethanone |
|---|---|
| PubChem CID | 157389294 |
| Molecular Formula | C16H13BN4O3 |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-(1-pyridin-2-yltriazol-4-yl)ethanone |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OC2)c1cn(-c2ccccn2)nn1 |
| InChI | InChI=1S/C16H13BN4O3/c22-15(8-11-4-5-12-10-24-17(23)13(12)7-11)14-9-21(20-19-14)16-3-1-2-6-18-16/h1-7,9,23H,8,10H2 |
| InChIKey | BLUOUZKHWYHCRN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|