C17H15BN4O4 — CID 153314533
2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-[5-(hydroxymethyl)-1-pyridin-2-yltriazol-4-yl]ethanone (PubChem CID 153314533) has the molecular formula C17H15BN4O4 and a molecular weight of 350.14 g/mol. Its IUPAC name is 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-[5-(hydroxymethyl)-1-pyridin-2-yltriazol-4-yl]ethanone.
| Compound Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-[5-(hydroxymethyl)-1-pyridin-2-yltriazol-4-yl]ethanone |
|---|---|
| PubChem CID | 153314533 |
| Molecular Formula | C17H15BN4O4 |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-[5-(hydroxymethyl)-1-pyridin-2-yltriazol-4-yl]ethanone |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OC2)c1nnn(-c2ccccn2)c1CO |
| InChI | InChI=1S/C17H15BN4O4/c23-9-14-17(20-21-22(14)16-3-1-2-6-19-16)15(24)8-11-4-5-12-10-26-18(25)13(12)7-11/h1-7,23,25H,8-10H2 |
| InChIKey | FKGSHLQMBNTUST-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|