C16H11BF3N5O3 — CID 142419726
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-pyridin-3-yl-5-(trifluoromethyl)triazole-4-carboxamide (PubChem CID 142419726) has the molecular formula C16H11BF3N5O3 and a molecular weight of 389.10 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-pyridin-3-yl-5-(trifluoromethyl)triazole-4-carboxamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-pyridin-3-yl-5-(trifluoromethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 142419726 |
| Molecular Formula | C16H11BF3N5O3 |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-pyridin-3-yl-5-(trifluoromethyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)B(O)OC2)c1nnn(-c2cccnc2)c1C(F)(F)F |
| InChI | InChI=1S/C16H11BF3N5O3/c18-16(19,20)14-13(23-24-25(14)11-2-1-5-21-7-11)15(26)22-10-4-3-9-8-28-17(27)12(9)6-10/h1-7,27H,8H2,(H,22,26) |
| InChIKey | YDNDXPZSTKNDBX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|