C15H14BNO5S — CID 171350170
N-(benzenesulfonyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetamide (PubChem CID 171350170) has the molecular formula C15H14BNO5S and a molecular weight of 331.16 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetamide |
|---|---|
| PubChem CID | 171350170 |
| Molecular Formula | C15H14BNO5S |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(benzenesulfonyl)-2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)B(O)OC2)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14BNO5S/c18-15(17-23(20,21)13-4-2-1-3-5-13)9-11-6-7-12-10-22-16(19)14(12)8-11/h1-8,19H,9-10H2,(H,17,18) |
| InChIKey | YVELWDCQEXOVON-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|