C13H11BNO4ReS- — CID 149211697
N-(1-hydroxy-3,5-dihydro-2,1-benzoxaborol-5-id-6-yl)benzenesulfonamide;rhenium (PubChem CID 149211697) has the molecular formula C13H11BNO4ReS- and a molecular weight of 474.32 g/mol. Its IUPAC name is N-(1-hydroxy-3,5-dihydro-2,1-benzoxaborol-5-id-6-yl)benzenesulfonamide;rhenium.
| Compound Name | N-(1-hydroxy-3,5-dihydro-2,1-benzoxaborol-5-id-6-yl)benzenesulfonamide;rhenium |
|---|---|
| PubChem CID | 149211697 |
| Molecular Formula | C13H11BNO4ReS- |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | N-(1-hydroxy-3,5-dihydro-2,1-benzoxaborol-5-id-6-yl)benzenesulfonamide;rhenium |
| SMILES | O=S(=O)(Nc1[c-]cc2c(c1)B(O)OC2)c1ccccc1.[Re] |
| InChI | InChI=1S/C13H11BNO4S.Re/c16-14-13-8-11(7-6-10(13)9-19-14)15-20(17,18)12-4-2-1-3-5-12;/h1-6,8,15-16H,9H2;/q-1; |
| InChIKey | KZCKUMOXXPIGGC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|