C14H12BNO5S — CID 171347957
N-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfonyl]benzamide (PubChem CID 171347957) has the molecular formula C14H12BNO5S and a molecular weight of 317.13 g/mol. Its IUPAC name is N-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfonyl]benzamide.
| Compound Name | N-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfonyl]benzamide |
|---|---|
| PubChem CID | 171347957 |
| Molecular Formula | C14H12BNO5S |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfonyl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc2c(c1)B(O)OC2)c1ccccc1 |
| InChI | InChI=1S/C14H12BNO5S/c17-14(10-4-2-1-3-5-10)16-22(19,20)12-7-6-11-9-21-15(18)13(11)8-12/h1-8,18H,9H2,(H,16,17) |
| InChIKey | OECCLITWGLEFFD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|