C15H19F3O — CID 115792152
1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-1-one (PubChem CID 115792152) has the molecular formula C15H19F3O and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 115792152 |
| Molecular Formula | C15H19F3O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3O/c1-14(2,3)12-8-6-11(7-9-12)13(19)5-4-10-15(16,17)18/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | FGVDLCVQKLCCSV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |